| Abstract
| - A three-dimensional iron(III) diphosphonate, FeIII(H2O)(HO3P(CH2)2PO3), I, has been synthesized hydrothermallyand characterized by single-crystal X-ray diffraction. The compound crystallizes in the orthorhombic space groupPbca (no. 61) where a = 9.739(5) Å, b = 9.498(5) Å, c = 15.940(8) Å, V = 1474.4(1) Å3, Z = 8, and R1 =0.0380. The structure consists of inorganic sheets pillared by the 1,2-ethylenediphosphonate groups. The sheetsare composed of Fe(H2O)O5 octahedra connected through PO3C tetrahedra. The corresponding isostructural aluminum(II) and gallium (III) compounds were also synthesized and indexed: II, a = 9.534(1) Å, b = 9.255(2) Å, c =15.724(1) Å, V = 1387.5(1) Å3; III, a = 9.670(1) Å, b = 9.357(2) Å, c = 15.862(4) Å, V = 1435.4(1) Å3.
- A three-dimensional iron ethylenediphosphonate, FeIII(H2O)(HO3P(CH2)2PO3), I, has been synthesized hydrothermally and characterized by single-crystal X-ray diffraction. The structure consists of sheets of Fe(H2O)O5 octahedra together with corner-sharing PO3C tetrahedra; the sheets are pillared by the 1,2-ethylenediphosphonate groups. Isostructural aluminum, II, and gallium, III, compounds were also synthesized, and their unit cell parameters were determined.
|
